Name | 2-oxovaleric acid |
Synonyms | Ketovalericacid 2-oxovaleric acid 2-OXOPENTANOIC ACID 2-oxo-n-valeric acid Pentanoic acid, 2-oxo- ALPHA-KETOVALERIC ACID ALPHA-KETO-N-VALERIC ACID A-ketovaleric acid free acid α-Ketovaleric acid, 2-Oxopentanoic acid |
CAS | 1821-02-9 |
EINECS | 217-340-2 |
InChI | InChI=1/C5H8O3/c1-2-3-4(6)5(7)8/h2-3H2,1H3,(H,7,8) |
Molecular Formula | C5H8O3 |
Molar Mass | 116.12 |
Density | 1.110 g/mL at 20 °C(lit.) |
Melting Point | 7-9℃ |
Boling Point | 88℃(12 torr) |
Flash Point | 94°C |
Storage Condition | 2-8℃ |
Refractive Index | n20/D 1.432 |
MDL | MFCD00066435 |
Physical and Chemical Properties | Bioactive 2-Oxovaleric acid is a keto acid found in human blood. |
Hazard Symbols | Xi - Irritant |
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
melting point | 7-9 °C(lit.) |
boiling point | 88-90 °C12mm Hg(lit.) |
density | 1.110 g/mL at 20 °C(lit.) |
refractive index | n20/D 1.432 |
flash point | 94°C |
storage conditions | 2-8°C |
acidity coefficient (pKa) | 2.65±0.54(Predicted) |
BRN | 635884 |
dangerous goods mark | Xi |
hazard category code | 36/37/38 |
safety instructions | 26-36 |
WGK Germany | 3 |
F | 10-21 |
Human Endogenous Metabolite